C12H23N2+ — CID 167354801
4,6-dimethyl-1,3-di(propan-2-yl)-2H-pyrimidin-3-ium (PubChem CID 167354801) has the molecular formula C12H23N2+ and a molecular weight of 195.33 g/mol. Its IUPAC name is 4,6-dimethyl-1,3-di(propan-2-yl)-2H-pyrimidin-3-ium.
| Compound Name | 4,6-dimethyl-1,3-di(propan-2-yl)-2H-pyrimidin-3-ium |
|---|---|
| PubChem CID | 167354801 |
| Molecular Formula | C12H23N2+ |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.19 |
| IUPAC Name | 4,6-dimethyl-1,3-di(propan-2-yl)-2H-pyrimidin-3-ium |
| SMILES | CC1=CC(C)=[N+](C(C)C)CN1C(C)C |
| InChI | InChI=1S/C12H23N2/c1-9(2)13-8-14(10(3)4)12(6)7-11(13)5/h7,9-10H,8H2,1-6H3/q+1 |
| InChIKey | LGLGCZAADZVODC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|