C21H20Cl2N2O2 — CID 16735549
7-(2,3-dichlorophenyl)-1-(5-pyridin-2-yl-1,3-oxazol-2-yl)heptan-1-one (PubChem CID 16735549) has the molecular formula C21H20Cl2N2O2 and a molecular weight of 403.31 g/mol. Its IUPAC name is 7-(2,3-dichlorophenyl)-1-(5-pyridin-2-yl-1,3-oxazol-2-yl)heptan-1-one.
| Compound Name | 7-(2,3-dichlorophenyl)-1-(5-pyridin-2-yl-1,3-oxazol-2-yl)heptan-1-one |
|---|---|
| PubChem CID | 16735549 |
| Molecular Formula | C21H20Cl2N2O2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 7-(2,3-dichlorophenyl)-1-(5-pyridin-2-yl-1,3-oxazol-2-yl)heptan-1-one |
| SMILES | O=C(CCCCCCc1cccc(Cl)c1Cl)c1ncc(-c2ccccn2)o1 |
| InChI | InChI=1S/C21H20Cl2N2O2/c22-16-10-7-9-15(20(16)23)8-3-1-2-4-12-18(26)21-25-14-19(27-21)17-11-5-6-13-24-17/h5-7,9-11,13-14H,1-4,8,12H2 |
| InChIKey | OOPSZFOFVBJXMF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|