C48H34F6N3OPt- — CID 167355646
2-[1-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)benzimidazol-2-yl]phenol;platinum (PubChem CID 167355646) has the molecular formula C48H34F6N3OPt- and a molecular weight of 977.89 g/mol. Its IUPAC name is 2-[1-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[1-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 167355646 |
| Molecular Formula | C48H34F6N3OPt- |
| Molecular Weight | 977.89 g/mol |
| Exact Mass | 977.23 |
| IUPAC Name | 2-[1-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2ccccn2)[c-]c(-c2cccc3c2nc(-c2ccccc2O)n3-c2cc(-c3ccc(C(F)(F)F)cc3)cc(-c3ccc(C(F)(F)F)cc3)c2)c1.[Pt] |
| InChI | InChI=1S/C48H34F6N3O.Pt/c1-46(2,3)37-25-33(24-34(26-37)41-11-6-7-22-55-41)39-10-8-12-42-44(39)56-45(40-9-4-5-13-43(40)58)57(42)38-27-31(29-14-18-35(19-15-29)47(49,50)51)23-32(28-38)30-16-20-36(21-17-30)48(52,53)54;/h4-23,25-28,58H,1-3H3;/q-1; |
| InChIKey | INYUDCATKFSZSR-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.89 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|