C16H33N3O2 — CID 167356517
N-[3-amino-1-(hexylamino)-1-oxopropan-2-yl]heptanamide (PubChem CID 167356517) has the molecular formula C16H33N3O2 and a molecular weight of 299.46 g/mol. Its IUPAC name is N-[3-amino-1-(hexylamino)-1-oxopropan-2-yl]heptanamide.
| Compound Name | N-[3-amino-1-(hexylamino)-1-oxopropan-2-yl]heptanamide |
|---|---|
| PubChem CID | 167356517 |
| Molecular Formula | C16H33N3O2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | N-[3-amino-1-(hexylamino)-1-oxopropan-2-yl]heptanamide |
| SMILES | CCCCCCNC(=O)C(CN)NC(=O)CCCCCC |
| InChI | InChI=1S/C16H33N3O2/c1-3-5-7-9-11-15(20)19-14(13-17)16(21)18-12-10-8-6-4-2/h14H,3-13,17H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | NELQSHJSUVIEKV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|