About 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine
9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine (PubChem CID 16735701) has the molecular formula C16H18BrN5O4
and a molecular weight of 424.26 g/mol. Its IUPAC name is 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine.
Molecular Properties
| Compound Name | 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine |
| PubChem CID | 16735701 |
| Molecular Formula | C16H18BrN5O4 |
| Molecular Weight | 424.26 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine |
| SMILES | COc1cc(Cn2cnc3c(OC)nc(N)nc32)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C16H18BrN5O4/c1-23-9-5-8(10(17)13(25-3)12(9)24-2)6-22-7-19-11-14(22)20-16(18)21-15(11)26-4/h5,7H,6H2,1-4H3,(H2,18,20,21) |
| InChIKey | JZSHGWXFKPGPOC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine?
The IUPAC name of 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine (CID 16735701) is 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine.
What is the SMILES notation for 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine?
The canonical SMILES for 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine is COc1cc(Cn2cnc3c(OC)nc(N)nc32)c(Br)c(OC)c1OC.
What is the InChIKey of 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine?
The InChIKey is JZSHGWXFKPGPOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18BrN5O4/c1-23-9-5-8(10(17)13(25-3)12(9)24-2)6-22-7-19-11-14(22)20-16(18)21-15(11)26-4/h5,7H,6H2,1-4H3,(H2,18,20,21).
What are the key properties of 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine?
9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine has a molecular weight of 424.26 g/mol, XLogP of 2.25, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-methoxypurin-2-amine is sourced from PubChem (CID 16735701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).