C15H16BrN5O3S — CID 16735702
2-amino-9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-3H-purine-6-thione (PubChem CID 16735702) has the molecular formula C15H16BrN5O3S and a molecular weight of 426.30 g/mol. Its IUPAC name is 2-amino-9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-3H-purine-6-thione.
| Compound Name | 2-amino-9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-3H-purine-6-thione |
|---|---|
| PubChem CID | 16735702 |
| Molecular Formula | C15H16BrN5O3S |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 2-amino-9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-3H-purine-6-thione |
| SMILES | COc1cc(Cn2cnc3c(=S)nc(N)[nH]c32)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C15H16BrN5O3S/c1-22-8-4-7(9(16)12(24-3)11(8)23-2)5-21-6-18-10-13(21)19-15(17)20-14(10)25/h4,6H,5H2,1-3H3,(H3,17,19,20,25) |
| InChIKey | RWNQSAJAMOFEFO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|