C16H30N2O4 — CID 167357096
tert-butyl (3R,4S)-3-(hexylcarbamoyl)-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 167357096) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-(hexylcarbamoyl)-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-(hexylcarbamoyl)-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 167357096 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | tert-butyl (3R,4S)-3-(hexylcarbamoyl)-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | CCCCCCNC(=O)[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1O |
| InChI | InChI=1S/C16H30N2O4/c1-5-6-7-8-9-17-14(20)12-10-18(11-13(12)19)15(21)22-16(2,3)4/h12-13,19H,5-11H2,1-4H3,(H,17,20)/t12-,13-/m1/s1 |
| InChIKey | PQANHBICHULVGR-CHWSQXEVSA-N |
| XLogP | 1.91 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|