C30H18Br2ClN — CID 167358333
9-(3,5-dibromo-4-chlorophenyl)-3,6-diphenylcarbazole (PubChem CID 167358333) has the molecular formula C30H18Br2ClN and a molecular weight of 587.74 g/mol. Its IUPAC name is 9-(3,5-dibromo-4-chlorophenyl)-3,6-diphenylcarbazole.
| Compound Name | 9-(3,5-dibromo-4-chlorophenyl)-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 167358333 |
| Molecular Formula | C30H18Br2ClN |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 584.95 |
| IUPAC Name | 9-(3,5-dibromo-4-chlorophenyl)-3,6-diphenylcarbazole |
| SMILES | Clc1c(Br)cc(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)cc1Br |
| InChI | InChI=1S/C30H18Br2ClN/c31-26-17-23(18-27(32)30(26)33)34-28-13-11-21(19-7-3-1-4-8-19)15-24(28)25-16-22(12-14-29(25)34)20-9-5-2-6-10-20/h1-18H |
| InChIKey | HHFNZLCDOLZFKC-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|