About 6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide
6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide (PubChem CID 16735838) has the molecular formula C20H19N3O3
and a molecular weight of 349.39 g/mol. Its IUPAC name is 6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide.
Molecular Properties
| Compound Name | 6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide |
| PubChem CID | 16735838 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide |
| SMILES | O=C(CCCCC(=O)c1ncc(-c2ccccn2)o1)Nc1ccccc1 |
| InChI | InChI=1S/C20H19N3O3/c24-17(20-22-14-18(26-20)16-10-6-7-13-21-16)11-4-5-12-19(25)23-15-8-2-1-3-9-15/h1-3,6-10,13-14H,4-5,11-12H2,(H,23,25) |
| InChIKey | IJANKEVONHQJMK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide?
The IUPAC name of 6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide (CID 16735838) is 6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide.
What is the SMILES notation for 6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide?
The canonical SMILES for 6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide is O=C(CCCCC(=O)c1ncc(-c2ccccn2)o1)Nc1ccccc1.
What is the InChIKey of 6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide?
The InChIKey is IJANKEVONHQJMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O3/c24-17(20-22-14-18(26-20)16-10-6-7-13-21-16)11-4-5-12-19(25)23-15-8-2-1-3-9-15/h1-3,6-10,13-14H,4-5,11-12H2,(H,23,25).
What are the key properties of 6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide?
6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide has a molecular weight of 349.39 g/mol, XLogP of 4.12, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-N-phenyl-6-(5-pyridin-2-yl-1,3-oxazol-2-yl)hexanamide is sourced from PubChem (CID 16735838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).