About N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine
N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine (PubChem CID 167358675) has the molecular formula C7H17N5
and a molecular weight of 171.25 g/mol. Its IUPAC name is N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine |
| PubChem CID | 167358675 |
| Molecular Formula | C7H17N5 |
| Molecular Weight | 171.25 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine |
| SMILES | CCN(C)CCNCCN=[N+]=[N-] |
| InChI | InChI=1S/C7H17N5/c1-3-12(2)7-6-9-4-5-10-11-8/h9H,3-7H2,1-2H3 |
| InChIKey | LQCYKWFJNKWLMY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine?
The IUPAC name of N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine (CID 167358675) is N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine.
What is the SMILES notation for N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine?
The canonical SMILES for N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine is CCN(C)CCNCCN=[N+]=[N-].
What is the InChIKey of N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine?
The InChIKey is LQCYKWFJNKWLMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N5/c1-3-12(2)7-6-9-4-5-10-11-8/h9H,3-7H2,1-2H3.
What are the key properties of N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine?
N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine has a molecular weight of 171.25 g/mol, XLogP of 0.84, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-azidoethyl)-N'-ethyl-N'-methylethane-1,2-diamine is sourced from PubChem (CID 167358675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).