About 6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine
6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine (PubChem CID 16735916) has the molecular formula C14H15ClN6S
and a molecular weight of 334.84 g/mol. Its IUPAC name is 6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine.
Molecular Properties
| Compound Name | 6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine |
| PubChem CID | 16735916 |
| Molecular Formula | C14H15ClN6S |
| Molecular Weight | 334.84 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine |
| SMILES | CSc1c(C)cnc(Cn2cnc3c(Cl)nc(N)nc32)c1C |
| InChI | InChI=1S/C14H15ClN6S/c1-7-4-17-9(8(2)11(7)22-3)5-21-6-18-10-12(15)19-14(16)20-13(10)21/h4,6H,5H2,1-3H3,(H2,16,19,20) |
| InChIKey | YUMPZOGCTVEPBT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.84 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine?
The IUPAC name of 6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine (CID 16735916) is 6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine.
What is the SMILES notation for 6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine?
The canonical SMILES for 6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine is CSc1c(C)cnc(Cn2cnc3c(Cl)nc(N)nc32)c1C.
What is the InChIKey of 6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine?
The InChIKey is YUMPZOGCTVEPBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN6S/c1-7-4-17-9(8(2)11(7)22-3)5-21-6-18-10-12(15)19-14(16)20-13(10)21/h4,6H,5H2,1-3H3,(H2,16,19,20).
What are the key properties of 6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine?
6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine has a molecular weight of 334.84 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]purin-2-amine is sourced from PubChem (CID 16735916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).