About US12263171, Example 100
US12263171, Example 100 (PubChem CID 167359236) has the molecular formula C22H23F2N7O2
and a molecular weight of 455.50 g/mol. Its IUPAC name is 2-[(3R)-1-[6-(difluoromethoxy)-5-methyl-3-pyridinyl]piperidin-3-yl]-7-methoxy-[1,2,4]triazolo[1,5-c]quinazolin-5-amine.
Molecular Properties
| Compound Name | US12263171, Example 100 |
| PubChem CID | 167359236 |
| Molecular Formula | C22H23F2N7O2 |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 2-[(3R)-1-[6-(difluoromethoxy)-5-methyl-3-pyridinyl]piperidin-3-yl]-7-methoxy-[1,2,4]triazolo[1,5-c]quinazolin-5-amine |
| SMILES | CC1=CC(=CN=C1OC(F)F)N2CCC[C@H](C2)C3=NN4C(=N3)C5=C(C(=CC=C5)OC)N=C4N |
| InChI | InChI=1S/C22H23F2N7O2/c1-12-9-14(10-26-20(12)33-21(23)24)30-8-4-5-13(11-30)18-28-19-15-6-3-7-16(32-2)17(15)27-22(25)31(19)29-18/h3,6-7,9-10,13,21H,4-5,8,11H2,1-2H3,(H2,25,27)/t13-/m1/s1 |
| InChIKey | SRVZCTYMKCVQRK-CYBMUJFWSA-N |
| XLogP | 4.00 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | 664 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze US12263171, Example 100 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US12263171, Example 100?
The IUPAC name of US12263171, Example 100 (CID 167359236) is 2-[(3R)-1-[6-(difluoromethoxy)-5-methyl-3-pyridinyl]piperidin-3-yl]-7-methoxy-[1,2,4]triazolo[1,5-c]quinazolin-5-amine.
What is the SMILES notation for US12263171, Example 100?
The canonical SMILES for US12263171, Example 100 is CC1=CC(=CN=C1OC(F)F)N2CCC[C@H](C2)C3=NN4C(=N3)C5=C(C(=CC=C5)OC)N=C4N.
What is the InChIKey of US12263171, Example 100?
The InChIKey is SRVZCTYMKCVQRK-CYBMUJFWSA-N. The full InChI is InChI=1S/C22H23F2N7O2/c1-12-9-14(10-26-20(12)33-21(23)24)30-8-4-5-13(11-30)18-28-19-15-6-3-7-16(32-2)17(15)27-22(25)31(19)29-18/h3,6-7,9-10,13,21H,4-5,8,11H2,1-2H3,(H2,25,27)/t13-/m1/s1.
What are the key properties of US12263171, Example 100?
US12263171, Example 100 has a molecular weight of 455.50 g/mol, XLogP of 4.00, 5 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for US12263171, Example 100 is sourced from PubChem (CID 167359236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).