C45H50N4S5 — CID 167359497
6-butyl-4,9-bis[2-(4-ethyloct-1-ynyl)thieno[3,2-b]thiophen-5-yl]-7-methyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 167359497) has the molecular formula C45H50N4S5 and a molecular weight of 807.26 g/mol. Its IUPAC name is 6-butyl-4,9-bis[2-(4-ethyloct-1-ynyl)thieno[3,2-b]thiophen-5-yl]-7-methyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 6-butyl-4,9-bis[2-(4-ethyloct-1-ynyl)thieno[3,2-b]thiophen-5-yl]-7-methyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 167359497 |
| Molecular Formula | C45H50N4S5 |
| Molecular Weight | 807.26 g/mol |
| Exact Mass | 806.26 |
| IUPAC Name | 6-butyl-4,9-bis[2-(4-ethyloct-1-ynyl)thieno[3,2-b]thiophen-5-yl]-7-methyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | CCCCc1nc2c(-c3cc4sc(C#CCC(CC)CCCC)cc4s3)c3nsnc3c(-c3cc4sc(C#CCC(CC)CCCC)cc4s3)c2nc1C |
| InChI | InChI=1S/C45H50N4S5/c1-7-12-17-29(10-4)19-15-21-31-24-34-36(50-31)26-38(52-34)40-42-43(47-33(23-14-9-3)28(6)46-42)41(45-44(40)48-54-49-45)39-27-37-35(53-39)25-32(51-37)22-16-20-30(11-5)18-13-8-2/h24-27,29-30H,7-14,17-20,23H2,1-6H3 |
| InChIKey | GYMPNDQZHGZFRJ-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.26 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|