C20H13N5O — CID 167359929
2-[[7-(3-isocyano-2H-indazol-5-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile (PubChem CID 167359929) has the molecular formula C20H13N5O and a molecular weight of 339.36 g/mol. Its IUPAC name is 2-[[7-(3-isocyano-2H-indazol-5-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile.
| Compound Name | 2-[[7-(3-isocyano-2H-indazol-5-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 167359929 |
| Molecular Formula | C20H13N5O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-[[7-(3-isocyano-2H-indazol-5-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile |
| SMILES | [C-]#[N+]c1[nH]nc2ccc(-c3cccc4c3CN(CC(=C)C#N)C4=O)cc12 |
| InChI | InChI=1S/C20H13N5O/c1-12(9-21)10-25-11-17-14(4-3-5-15(17)20(25)26)13-6-7-18-16(8-13)19(22-2)24-23-18/h3-8H,1,10-11H2,(H,23,24) |
| InChIKey | SUPHTXUKQOOZEY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|