About 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one
1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one (PubChem CID 16736010) has the molecular formula C22H18N2O3
and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one.
Molecular Properties
| Compound Name | 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one |
| PubChem CID | 16736010 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one |
| SMILES | O=C(CCc1ccc(OCc2ccccc2)cc1)c1nc2ncccc2o1 |
| InChI | InChI=1S/C22H18N2O3/c25-19(22-24-21-20(27-22)7-4-14-23-21)13-10-16-8-11-18(12-9-16)26-15-17-5-2-1-3-6-17/h1-9,11-12,14H,10,13,15H2 |
| InChIKey | HEIXLGZCGUTTNY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one?
The IUPAC name of 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one (CID 16736010) is 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one.
What is the SMILES notation for 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one?
The canonical SMILES for 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one is O=C(CCc1ccc(OCc2ccccc2)cc1)c1nc2ncccc2o1.
What is the InChIKey of 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one?
The InChIKey is HEIXLGZCGUTTNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O3/c25-19(22-24-21-20(27-22)7-4-14-23-21)13-10-16-8-11-18(12-9-16)26-15-17-5-2-1-3-6-17/h1-9,11-12,14H,10,13,15H2.
What are the key properties of 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one?
1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one has a molecular weight of 358.40 g/mol, XLogP of 4.62, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-3-(4-phenylmethoxyphenyl)propan-1-one is sourced from PubChem (CID 16736010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).