About 2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol
2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol (PubChem CID 167360680) has the molecular formula C13H16N2OS
and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol |
| PubChem CID | 167360680 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol |
| SMILES | Cc1nnc(-c2ccc(C(C)(C)C)c(O)c2)s1 |
| InChI | InChI=1S/C13H16N2OS/c1-8-14-15-12(17-8)9-5-6-10(11(16)7-9)13(2,3)4/h5-7,16H,1-4H3 |
| InChIKey | URDWUCIPNGMVMJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol?
The IUPAC name of 2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol (CID 167360680) is 2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol.
What is the SMILES notation for 2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol?
The canonical SMILES for 2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol is Cc1nnc(-c2ccc(C(C)(C)C)c(O)c2)s1.
What is the InChIKey of 2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol?
The InChIKey is URDWUCIPNGMVMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2OS/c1-8-14-15-12(17-8)9-5-6-10(11(16)7-9)13(2,3)4/h5-7,16H,1-4H3.
What are the key properties of 2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol?
2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol has a molecular weight of 248.35 g/mol, XLogP of 3.52, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol is sourced from PubChem (CID 167360680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).