C20H28CuN6OS2 — CID 167361209
copper N'-ethyl-N-[(E)-[(2E,3R)-2-[(N-ethyl-C-sulfidocarbonimidoyl)hydrazinylidene]-3-(2-phenylmethoxyethyl)cyclopentylidene]amino]carbamimidothioate (PubChem CID 167361209) has the molecular formula C20H28CuN6OS2 and a molecular weight of 496.17 g/mol. Its IUPAC name is copper N'-ethyl-N-[(E)-[(2E,3R)-2-[(N-ethyl-C-sulfidocarbonimidoyl)hydrazinylidene]-3-(2-phenylmethoxyethyl)cyclopentylidene]amino]carbamimidothioate.
| Compound Name | copper N'-ethyl-N-[(E)-[(2E,3R)-2-[(N-ethyl-C-sulfidocarbonimidoyl)hydrazinylidene]-3-(2-phenylmethoxyethyl)cyclopentylidene]amino]carbamimidothioate |
|---|---|
| PubChem CID | 167361209 |
| Molecular Formula | C20H28CuN6OS2 |
| Molecular Weight | 496.17 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | copper N'-ethyl-N-[(E)-[(2E,3R)-2-[(N-ethyl-C-sulfidocarbonimidoyl)hydrazinylidene]-3-(2-phenylmethoxyethyl)cyclopentylidene]amino]carbamimidothioate |
| SMILES | CC/N=C(\[S-])N/N=C1\CC[C@H](CCOCc2ccccc2)\C1=N/N/C([S-])=N\CC.[Cu+2] |
| InChI | InChI=1S/C20H30N6OS2.Cu/c1-3-21-19(28)25-23-17-11-10-16(18(17)24-26-20(29)22-4-2)12-13-27-14-15-8-6-5-7-9-15;/h5-9,16H,3-4,10-14H2,1-2H3,(H2,21,25,28)(H2,22,26,29);/q;+2/p-2/b23-17+,24-18+;/t16-;/m1./s1 |
| InChIKey | GHBBBDAKAWADEO-DRSQECKUSA-L |
| XLogP | 2.74 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.17 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|