C24H34O4 — CID 167362663
ethyl 2,4-dihydroxy-6-pentyl-3-[(6S)-6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzoate (PubChem CID 167362663) has the molecular formula C24H34O4 and a molecular weight of 389.55 g/mol. Its IUPAC name is ethyl 2,4-dihydroxy-6-pentyl-3-[(6S)-6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzoate.
| Compound Name | ethyl 2,4-dihydroxy-6-pentyl-3-[(6S)-6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzoate |
|---|---|
| PubChem CID | 167362663 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | ethyl 2,4-dihydroxy-6-pentyl-3-[(6S)-6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzoate |
| SMILES | [2H]C([2H])([2H])C1=CC(c2c(O)cc(CCCCC)c(C(=O)OCC)c2O)[C@@H](C(=C)C)CC1 |
| InChI | InChI=1S/C24H34O4/c1-6-8-9-10-17-14-20(25)22(23(26)21(17)24(27)28-7-2)19-13-16(5)11-12-18(19)15(3)4/h13-14,18-19,25-26H,3,6-12H2,1-2,4-5H3/t18-,19?/m1/s1/i5D3 |
| InChIKey | MDYOBKSGBCAWFU-AVYJHRNDSA-N |
| XLogP | 6.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|