About ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate
ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate (PubChem CID 167362743) has the molecular formula C15H27NO3
and a molecular weight of 269.38 g/mol. Its IUPAC name is ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate |
| PubChem CID | 167362743 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate |
| SMILES | CCCCCCC1(C(=O)OCC)CC(C(C)C)=NO1 |
| InChI | InChI=1S/C15H27NO3/c1-5-7-8-9-10-15(14(17)18-6-2)11-13(12(3)4)16-19-15/h12H,5-11H2,1-4H3 |
| InChIKey | WUICJUIYCCNIEW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate?
The IUPAC name of ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate (CID 167362743) is ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate?
The canonical SMILES for ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate is CCCCCCC1(C(=O)OCC)CC(C(C)C)=NO1.
What is the InChIKey of ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate?
The InChIKey is WUICJUIYCCNIEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO3/c1-5-7-8-9-10-15(14(17)18-6-2)11-13(12(3)4)16-19-15/h12H,5-11H2,1-4H3.
What are the key properties of ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate?
ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate has a molecular weight of 269.38 g/mol, XLogP of 3.69, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-hexyl-3-propan-2-yl-4H-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 167362743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).