About ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate
ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate (PubChem CID 167362831) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate.
Molecular Properties
| Compound Name | ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate |
| PubChem CID | 167362831 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate |
| SMILES | CCOC(=O)C(C)(C)C1(C)CC(C(C)C)=NO1 |
| InChI | InChI=1S/C13H23NO3/c1-7-16-11(15)12(4,5)13(6)8-10(9(2)3)14-17-13/h9H,7-8H2,1-6H3 |
| InChIKey | GIUPQCFZJXNHMA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate?
The IUPAC name of ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate (CID 167362831) is ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate.
What is the SMILES notation for ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate?
The canonical SMILES for ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate is CCOC(=O)C(C)(C)C1(C)CC(C(C)C)=NO1.
What is the InChIKey of ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate?
The InChIKey is GIUPQCFZJXNHMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO3/c1-7-16-11(15)12(4,5)13(6)8-10(9(2)3)14-17-13/h9H,7-8H2,1-6H3.
What are the key properties of ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate?
ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate has a molecular weight of 241.33 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-2-(5-methyl-3-propan-2-yl-4H-1,2-oxazol-5-yl)propanoate is sourced from PubChem (CID 167362831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).