About 2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one
2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one (PubChem CID 167362930) has the molecular formula C13H13ClF3N3O
and a molecular weight of 319.71 g/mol. Its IUPAC name is 2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one.
Molecular Properties
| Compound Name | 2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one |
| PubChem CID | 167362930 |
| Molecular Formula | C13H13ClF3N3O |
| Molecular Weight | 319.71 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one |
| SMILES | CN1C(=O)C2(CCC(C(F)(F)F)CC2)c2nc(Cl)ncc21 |
| InChI | InChI=1S/C13H13ClF3N3O/c1-20-8-6-18-11(14)19-9(8)12(10(20)21)4-2-7(3-5-12)13(15,16)17/h6-7H,2-5H2,1H3 |
| InChIKey | UGQJENVNICMTDZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.71 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one?
The IUPAC name of 2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one (CID 167362930) is 2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one.
What is the SMILES notation for 2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one?
The canonical SMILES for 2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one is CN1C(=O)C2(CCC(C(F)(F)F)CC2)c2nc(Cl)ncc21.
What is the InChIKey of 2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one?
The InChIKey is UGQJENVNICMTDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClF3N3O/c1-20-8-6-18-11(14)19-9(8)12(10(20)21)4-2-7(3-5-12)13(15,16)17/h6-7H,2-5H2,1H3.
What are the key properties of 2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one?
2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one has a molecular weight of 319.71 g/mol, XLogP of 3.10, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-chloro-5'-methyl-4-(trifluoromethyl)spiro[cyclohexane-1,7'-pyrrolo[3,2-d]pyrimidine]-6'-one is sourced from PubChem (CID 167362930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).