C23H24FNO3 — CID 16736332
3-[[4-(5-cyclopentyl-1-benzofuran-2-yl)-3-fluorophenyl]methylamino]propanoic acid (PubChem CID 16736332) has the molecular formula C23H24FNO3 and a molecular weight of 381.45 g/mol. Its IUPAC name is 3-[[4-(5-cyclopentyl-1-benzofuran-2-yl)-3-fluorophenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-(5-cyclopentyl-1-benzofuran-2-yl)-3-fluorophenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 16736332 |
| Molecular Formula | C23H24FNO3 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-[[4-(5-cyclopentyl-1-benzofuran-2-yl)-3-fluorophenyl]methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1ccc(-c2cc3cc(C4CCCC4)ccc3o2)c(F)c1 |
| InChI | InChI=1S/C23H24FNO3/c24-20-11-15(14-25-10-9-23(26)27)5-7-19(20)22-13-18-12-17(6-8-21(18)28-22)16-3-1-2-4-16/h5-8,11-13,16,25H,1-4,9-10,14H2,(H,26,27) |
| InChIKey | FHWCBQVCLUKTJA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|