C26H31N3O7 — CID 16736435
5-[(E)-1-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-(methoxyamino)-6-oxohex-1-enyl]-N,2-dimethoxy-3-methylbenzamide (PubChem CID 16736435) has the molecular formula C26H31N3O7 and a molecular weight of 497.55 g/mol. Its IUPAC name is 5-[(E)-1-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-(methoxyamino)-6-oxohex-1-enyl]-N,2-dimethoxy-3-methylbenzamide.
| Compound Name | 5-[(E)-1-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-(methoxyamino)-6-oxohex-1-enyl]-N,2-dimethoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 16736435 |
| Molecular Formula | C26H31N3O7 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 5-[(E)-1-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-(methoxyamino)-6-oxohex-1-enyl]-N,2-dimethoxy-3-methylbenzamide |
| SMILES | CONC(=O)CCC/C=C(\c1cc(C)c(OC)c(C(=O)NOC)c1)c1cc(C)c2oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C26H31N3O7/c1-15-11-17(13-20(23(15)33-4)25(31)28-35-6)19(9-7-8-10-22(30)27-34-5)18-12-16(2)24-21(14-18)29(3)26(32)36-24/h9,11-14H,7-8,10H2,1-6H3,(H,27,30)(H,28,31)/b19-9+ |
| InChIKey | FYSYQJDIJVRTDS-DJKKODMXSA-N |
| XLogP | 3.33 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|