C45H39F2N2S+ — CID 167365284
2-[7-(3,5-difluorophenyl)-3-methyldibenzothiophen-2-yl]-1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium (PubChem CID 167365284) has the molecular formula C45H39F2N2S+ and a molecular weight of 677.88 g/mol. Its IUPAC name is 2-[7-(3,5-difluorophenyl)-3-methyldibenzothiophen-2-yl]-1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium.
| Compound Name | 2-[7-(3,5-difluorophenyl)-3-methyldibenzothiophen-2-yl]-1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium |
|---|---|
| PubChem CID | 167365284 |
| Molecular Formula | C45H39F2N2S+ |
| Molecular Weight | 677.88 g/mol |
| Exact Mass | 677.28 |
| IUPAC Name | 2-[7-(3,5-difluorophenyl)-3-methyldibenzothiophen-2-yl]-1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium |
| SMILES | Cc1cc2sc3cc(-c4cc(F)cc(F)c4)ccc3c2cc1-c1n(-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C45H39F2N2S/c1-26(2)36-21-32(29-12-8-7-9-13-29)22-37(27(3)4)44(36)49-41-15-11-10-14-40(41)48(6)45(49)38-25-39-35-17-16-30(31-19-33(46)24-34(47)20-31)23-43(35)50-42(39)18-28(38)5/h7-27H,1-6H3/q+1 |
| InChIKey | CLDMOFALZUKFMN-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.88 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|