About 6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine
6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine (PubChem CID 16736530) has the molecular formula C15H17ClN6O
and a molecular weight of 332.80 g/mol. Its IUPAC name is 6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine.
Molecular Properties
| Compound Name | 6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine |
| PubChem CID | 16736530 |
| Molecular Formula | C15H17ClN6O |
| Molecular Weight | 332.80 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine |
| SMILES | CCOc1c(C)cnc(Cn2cnc3c(Cl)nc(N)nc32)c1C |
| InChI | InChI=1S/C15H17ClN6O/c1-4-23-12-8(2)5-18-10(9(12)3)6-22-7-19-11-13(16)20-15(17)21-14(11)22/h5,7H,4,6H2,1-3H3,(H2,17,20,21) |
| InChIKey | FJLJVVPUWXTQSB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.80 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine?
The IUPAC name of 6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine (CID 16736530) is 6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine.
What is the SMILES notation for 6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine?
The canonical SMILES for 6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine is CCOc1c(C)cnc(Cn2cnc3c(Cl)nc(N)nc32)c1C.
What is the InChIKey of 6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine?
The InChIKey is FJLJVVPUWXTQSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClN6O/c1-4-23-12-8(2)5-18-10(9(12)3)6-22-7-19-11-13(16)20-15(17)21-14(11)22/h5,7H,4,6H2,1-3H3,(H2,17,20,21).
What are the key properties of 6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine?
6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine has a molecular weight of 332.80 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-9-[(4-ethoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine is sourced from PubChem (CID 16736530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).