C24H20F2N4O2 — CID 167365331
5,6-difluoro-4-[6-(3-isocyano-3-methylbut-1-ynyl)-3,5-dihydro-2H-4,1-benzoxazepin-1-yl]-1-(trideuteriomethyl)quinazolin-2-one (PubChem CID 167365331) has the molecular formula C24H20F2N4O2 and a molecular weight of 437.46 g/mol. Its IUPAC name is 5,6-difluoro-4-[6-(3-isocyano-3-methylbut-1-ynyl)-3,5-dihydro-2H-4,1-benzoxazepin-1-yl]-1-(trideuteriomethyl)quinazolin-2-one.
| Compound Name | 5,6-difluoro-4-[6-(3-isocyano-3-methylbut-1-ynyl)-3,5-dihydro-2H-4,1-benzoxazepin-1-yl]-1-(trideuteriomethyl)quinazolin-2-one |
|---|---|
| PubChem CID | 167365331 |
| Molecular Formula | C24H20F2N4O2 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 5,6-difluoro-4-[6-(3-isocyano-3-methylbut-1-ynyl)-3,5-dihydro-2H-4,1-benzoxazepin-1-yl]-1-(trideuteriomethyl)quinazolin-2-one |
| SMILES | [2H]C([2H])([2H])n1c(=O)nc(N2CCOCc3c(C#CC(C)(C)[N+]#[C-])cccc32)c2c(F)c(F)ccc21 |
| InChI | InChI=1S/C24H20F2N4O2/c1-24(2,27-3)11-10-15-6-5-7-18-16(15)14-32-13-12-30(18)22-20-19(29(4)23(31)28-22)9-8-17(25)21(20)26/h5-9H,12-14H2,1-2,4H3/i4D3 |
| InChIKey | CFGBLLIZLMQHPV-GKOSEXJESA-N |
| XLogP | 3.93 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|