C20H26F2N2O — CID 167365345
6-[2-[1-(2,2-difluoroethyl)pyrrolidin-2-yl]ethynyl]-1-propan-2-yl-3,5-dihydro-2H-4,1-benzoxazepine (PubChem CID 167365345) has the molecular formula C20H26F2N2O and a molecular weight of 348.44 g/mol. Its IUPAC name is 6-[2-[1-(2,2-difluoroethyl)pyrrolidin-2-yl]ethynyl]-1-propan-2-yl-3,5-dihydro-2H-4,1-benzoxazepine.
| Compound Name | 6-[2-[1-(2,2-difluoroethyl)pyrrolidin-2-yl]ethynyl]-1-propan-2-yl-3,5-dihydro-2H-4,1-benzoxazepine |
|---|---|
| PubChem CID | 167365345 |
| Molecular Formula | C20H26F2N2O |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 6-[2-[1-(2,2-difluoroethyl)pyrrolidin-2-yl]ethynyl]-1-propan-2-yl-3,5-dihydro-2H-4,1-benzoxazepine |
| SMILES | CC(C)N1CCOCc2c(C#CC3CCCN3CC(F)F)cccc21 |
| InChI | InChI=1S/C20H26F2N2O/c1-15(2)24-11-12-25-14-18-16(5-3-7-19(18)24)8-9-17-6-4-10-23(17)13-20(21)22/h3,5,7,15,17,20H,4,6,10-14H2,1-2H3 |
| InChIKey | GDDXTRQQIUPYAW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|