C21H36O9 — CID 16736546
[(6R)-5-butanoyl-6-hydroxy-4,7-dioxo-6-[(1S,2R)-1,2,3-trihydroxypropyl]decan-5-yl] butanoate (PubChem CID 16736546) has the molecular formula C21H36O9 and a molecular weight of 432.51 g/mol. Its IUPAC name is [(6R)-5-butanoyl-6-hydroxy-4,7-dioxo-6-[(1S,2R)-1,2,3-trihydroxypropyl]decan-5-yl] butanoate.
| Compound Name | [(6R)-5-butanoyl-6-hydroxy-4,7-dioxo-6-[(1S,2R)-1,2,3-trihydroxypropyl]decan-5-yl] butanoate |
|---|---|
| PubChem CID | 16736546 |
| Molecular Formula | C21H36O9 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | [(6R)-5-butanoyl-6-hydroxy-4,7-dioxo-6-[(1S,2R)-1,2,3-trihydroxypropyl]decan-5-yl] butanoate |
| SMILES | CCCC(=O)OC(C(=O)CCC)(C(=O)CCC)[C@@](O)(C(=O)CCC)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C21H36O9/c1-5-9-15(24)20(29,19(28)14(23)13-22)21(16(25)10-6-2,17(26)11-7-3)30-18(27)12-8-4/h14,19,22-23,28-29H,5-13H2,1-4H3/t14-,19+,20-/m1/s1 |
| InChIKey | ZCKUPMGXFCLYQN-VOBQZIQPSA-N |
| XLogP | 0.62 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|