C34H29GeN2+ — CID 167365745
5,5,7-trimethyl-6-(1-methylpyridin-1-ium-2-yl)-3-(4-phenylphenyl)benzo[b][1]benzogermole-4-carbonitrile (PubChem CID 167365745) has the molecular formula C34H29GeN2+ and a molecular weight of 538.23 g/mol. Its IUPAC name is 5,5,7-trimethyl-6-(1-methylpyridin-1-ium-2-yl)-3-(4-phenylphenyl)benzo[b][1]benzogermole-4-carbonitrile.
| Compound Name | 5,5,7-trimethyl-6-(1-methylpyridin-1-ium-2-yl)-3-(4-phenylphenyl)benzo[b][1]benzogermole-4-carbonitrile |
|---|---|
| PubChem CID | 167365745 |
| Molecular Formula | C34H29GeN2+ |
| Molecular Weight | 538.23 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | 5,5,7-trimethyl-6-(1-methylpyridin-1-ium-2-yl)-3-(4-phenylphenyl)benzo[b][1]benzogermole-4-carbonitrile |
| SMILES | Cc1ccc2c(c1-c1cccc[n+]1C)[Ge](C)(C)c1c-2ccc(-c2ccc(-c3ccccc3)cc2)c1C#N |
| InChI | InChI=1S/C34H29GeN2/c1-23-13-18-29-28-20-19-27(26-16-14-25(15-17-26)24-10-6-5-7-11-24)30(22-36)33(28)35(2,3)34(29)32(23)31-12-8-9-21-37(31)4/h5-21H,1-4H3/q+1 |
| InChIKey | NZUBPXQZWIMBPG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.23 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|