C17H29O4P — CID 16736585
[(2Z,6E)-7,11-dimethyl-3-prop-2-enyldodeca-2,6,10-trienyl] dihydrogen phosphate (PubChem CID 16736585) has the molecular formula C17H29O4P and a molecular weight of 328.39 g/mol. Its IUPAC name is [(2Z,6E)-7,11-dimethyl-3-prop-2-enyldodeca-2,6,10-trienyl] dihydrogen phosphate.
| Compound Name | [(2Z,6E)-7,11-dimethyl-3-prop-2-enyldodeca-2,6,10-trienyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 16736585 |
| Molecular Formula | C17H29O4P |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | [(2Z,6E)-7,11-dimethyl-3-prop-2-enyldodeca-2,6,10-trienyl] dihydrogen phosphate |
| SMILES | C=CC/C(=C\COP(=O)(O)O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C17H29O4P/c1-5-8-17(13-14-21-22(18,19)20)12-7-11-16(4)10-6-9-15(2)3/h5,9,11,13H,1,6-8,10,12,14H2,2-4H3,(H2,18,19,20)/b16-11+,17-13+ |
| InChIKey | MNQQHQBXRZHHJO-IUBLYSDUSA-N |
| XLogP | 5.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|