C18H10Br2N6 — CID 16736652
5,12-bis(4-bromophenyl)-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene (PubChem CID 16736652) has the molecular formula C18H10Br2N6 and a molecular weight of 470.13 g/mol. Its IUPAC name is 5,12-bis(4-bromophenyl)-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene.
| Compound Name | 5,12-bis(4-bromophenyl)-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene |
|---|---|
| PubChem CID | 16736652 |
| Molecular Formula | C18H10Br2N6 |
| Molecular Weight | 470.13 g/mol |
| Exact Mass | 467.93 |
| IUPAC Name | 5,12-bis(4-bromophenyl)-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene |
| SMILES | Brc1ccc(-c2nnc3n2ccc2nnc(-c4ccc(Br)cc4)n23)cc1 |
| InChI | InChI=1S/C18H10Br2N6/c19-13-5-1-11(2-6-13)16-22-24-18-25(16)10-9-15-21-23-17(26(15)18)12-3-7-14(20)8-4-12/h1-10H |
| InChIKey | VEBIMHWTNUHWGD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.13 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |