About 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine
6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine (PubChem CID 167366791) has the molecular formula C22H23N7
and a molecular weight of 385.48 g/mol. Its IUPAC name is 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine.
Molecular Properties
| Compound Name | 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine |
| PubChem CID | 167366791 |
| Molecular Formula | C22H23N7 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine |
| SMILES | Cc1cccc(-c2[nH]ncc2-c2ccc3ncc(NC4CCNCC4)cc3n2)n1 |
| InChI | InChI=1S/C22H23N7/c1-14-3-2-4-20(26-14)22-17(13-25-29-22)18-5-6-19-21(28-18)11-16(12-24-19)27-15-7-9-23-10-8-15/h2-6,11-13,15,23,27H,7-10H2,1H3,(H,25,29) |
| InChIKey | ASHSIHXKAAXCKK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine?
The IUPAC name of 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine (CID 167366791) is 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine.
What is the SMILES notation for 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine?
The canonical SMILES for 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine is Cc1cccc(-c2[nH]ncc2-c2ccc3ncc(NC4CCNCC4)cc3n2)n1.
What is the InChIKey of 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine?
The InChIKey is ASHSIHXKAAXCKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N7/c1-14-3-2-4-20(26-14)22-17(13-25-29-22)18-5-6-19-21(28-18)11-16(12-24-19)27-15-7-9-23-10-8-15/h2-6,11-13,15,23,27H,7-10H2,1H3,(H,25,29).
What are the key properties of 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine?
6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine has a molecular weight of 385.48 g/mol, XLogP of 3.55, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-N-piperidin-4-yl-1,5-naphthyridin-3-amine is sourced from PubChem (CID 167366791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).