C27H47ClFN5O4 — CID 167367643
N-[(2S)-3-[5-chloro-6-(1,3-oxazolidin-5-ylmethoxy)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypropyl]-2-[(3-fluorocyclopentyl)amino]piperidine-4-carboxamide (PubChem CID 167367643) has the molecular formula C27H47ClFN5O4 and a molecular weight of 560.16 g/mol. Its IUPAC name is N-[(2S)-3-[5-chloro-6-(1,3-oxazolidin-5-ylmethoxy)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypropyl]-2-[(3-fluorocyclopentyl)amino]piperidine-4-carboxamide.
| Compound Name | N-[(2S)-3-[5-chloro-6-(1,3-oxazolidin-5-ylmethoxy)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypropyl]-2-[(3-fluorocyclopentyl)amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 167367643 |
| Molecular Formula | C27H47ClFN5O4 |
| Molecular Weight | 560.16 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | N-[(2S)-3-[5-chloro-6-(1,3-oxazolidin-5-ylmethoxy)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypropyl]-2-[(3-fluorocyclopentyl)amino]piperidine-4-carboxamide |
| SMILES | O=C(NC[C@H](O)CN1CCC2C(CCC(OCC3CNCO3)C2Cl)C1)C1CCNC(NC2CCC(F)C2)C1 |
| InChI | InChI=1S/C27H47ClFN5O4/c28-26-23-6-8-34(13-18(23)1-4-24(26)37-15-22-12-30-16-38-22)14-21(35)11-32-27(36)17-5-7-31-25(9-17)33-20-3-2-19(29)10-20/h17-26,30-31,33,35H,1-16H2,(H,32,36)/t17?,18?,19?,20?,21-,22?,23?,24?,25?,26?/m0/s1 |
| InChIKey | IIDDNIJPIXUFPY-ORVULUQISA-N |
| XLogP | 0.94 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.16 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|