C26H47ClN6O3 — CID 167367703
N-[(2S)-3-[5-chloro-6-(pyrazolidin-4-ylmethoxy)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypropyl]-2-(cyclobutylamino)piperidine-4-carboxamide (PubChem CID 167367703) has the molecular formula C26H47ClN6O3 and a molecular weight of 527.15 g/mol. Its IUPAC name is N-[(2S)-3-[5-chloro-6-(pyrazolidin-4-ylmethoxy)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypropyl]-2-(cyclobutylamino)piperidine-4-carboxamide.
| Compound Name | N-[(2S)-3-[5-chloro-6-(pyrazolidin-4-ylmethoxy)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypropyl]-2-(cyclobutylamino)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 167367703 |
| Molecular Formula | C26H47ClN6O3 |
| Molecular Weight | 527.15 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | N-[(2S)-3-[5-chloro-6-(pyrazolidin-4-ylmethoxy)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypropyl]-2-(cyclobutylamino)piperidine-4-carboxamide |
| SMILES | O=C(NC[C@H](O)CN1CCC2C(CCC(OCC3CNNC3)C2Cl)C1)C1CCNC(NC2CCC2)C1 |
| InChI | InChI=1S/C26H47ClN6O3/c27-25-22-7-9-33(14-19(22)4-5-23(25)36-16-17-11-30-31-12-17)15-21(34)13-29-26(35)18-6-8-28-24(10-18)32-20-2-1-3-20/h17-25,28,30-32,34H,1-16H2,(H,29,35)/t18?,19?,21-,22?,23?,24?,25?/m0/s1 |
| InChIKey | MNKAMYPJXLMSQQ-ABXQCMROSA-N |
| XLogP | 0.38 |
| TPSA | 109.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.15 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|