C22H23N5O2 — CID 167368432
2-[5-[[(1S,5R)-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]oxy]pyrazin-2-yl]-5-imidazol-1-ylphenol (PubChem CID 167368432) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-[5-[[(1S,5R)-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]oxy]pyrazin-2-yl]-5-imidazol-1-ylphenol.
| Compound Name | 2-[5-[[(1S,5R)-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]oxy]pyrazin-2-yl]-5-imidazol-1-ylphenol |
|---|---|
| PubChem CID | 167368432 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[5-[[(1S,5R)-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]oxy]pyrazin-2-yl]-5-imidazol-1-ylphenol |
| SMILES | C[C@]12C=C[C@](C)(CC(Oc3cnc(-c4ccc(-n5ccnc5)cc4O)cn3)C1)N2 |
| InChI | InChI=1S/C22H23N5O2/c1-21-5-6-22(2,26-21)11-16(10-21)29-20-13-24-18(12-25-20)17-4-3-15(9-19(17)28)27-8-7-23-14-27/h3-9,12-14,16,26,28H,10-11H2,1-2H3/t16?,21-,22+ |
| InChIKey | PQUZEEMFENXEDU-WKRVNPTQSA-N |
| XLogP | 3.25 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|