C30H52O5 — CID 16736855
(3R,5aR,6R,7S,9aR)-6-[2-[(5R,6S)-5-hydroxy-6-[(E)-4-hydroxy-4-methylpent-2-enyl]-2,6-dimethylcyclohexen-1-yl]ethyl]-2,2,5a,7-tetramethyl-4,5,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-3,7-diol (PubChem CID 16736855) has the molecular formula C30H52O5 and a molecular weight of 492.74 g/mol. Its IUPAC name is (3R,5aR,6R,7S,9aR)-6-[2-[(5R,6S)-5-hydroxy-6-[(E)-4-hydroxy-4-methylpent-2-enyl]-2,6-dimethylcyclohexen-1-yl]ethyl]-2,2,5a,7-tetramethyl-4,5,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-3,7-diol.
| Compound Name | (3R,5aR,6R,7S,9aR)-6-[2-[(5R,6S)-5-hydroxy-6-[(E)-4-hydroxy-4-methylpent-2-enyl]-2,6-dimethylcyclohexen-1-yl]ethyl]-2,2,5a,7-tetramethyl-4,5,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-3,7-diol |
|---|---|
| PubChem CID | 16736855 |
| Molecular Formula | C30H52O5 |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.38 |
| IUPAC Name | (3R,5aR,6R,7S,9aR)-6-[2-[(5R,6S)-5-hydroxy-6-[(E)-4-hydroxy-4-methylpent-2-enyl]-2,6-dimethylcyclohexen-1-yl]ethyl]-2,2,5a,7-tetramethyl-4,5,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-3,7-diol |
| SMILES | CC1=C(CC[C@@H]2[C@@]3(C)CC[C@@H](O)C(C)(C)O[C@@H]3CC[C@]2(C)O)[C@](C)(C/C=C/C(C)(C)O)[C@H](O)CC1 |
| InChI | InChI=1S/C30H52O5/c1-20-10-13-24(32)28(6,17-9-16-26(2,3)33)21(20)11-12-22-29(7)18-14-23(31)27(4,5)35-25(29)15-19-30(22,8)34/h9,16,22-25,31-34H,10-15,17-19H2,1-8H3/b16-9+/t22-,23-,24-,25-,28+,29-,30+/m1/s1 |
| InChIKey | WGFRLFUPNNMWTL-OLIMLXDHSA-N |
| XLogP | 5.45 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|