C24H24FN7O — CID 167368636
2-[5-[[(2R,3S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]pyrazin-2-yl]-5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)phenol (PubChem CID 167368636) has the molecular formula C24H24FN7O and a molecular weight of 445.50 g/mol. Its IUPAC name is 2-[5-[[(2R,3S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]pyrazin-2-yl]-5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)phenol.
| Compound Name | 2-[5-[[(2R,3S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]pyrazin-2-yl]-5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)phenol |
|---|---|
| PubChem CID | 167368636 |
| Molecular Formula | C24H24FN7O |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-[5-[[(2R,3S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]pyrazin-2-yl]-5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)phenol |
| SMILES | CN(c1cnc(-c2ccc(-c3nnc4ccccn34)cc2O)cn1)[C@H]1CC2CCC(N2)[C@H]1F |
| InChI | InChI=1S/C24H24FN7O/c1-31(19-11-15-6-8-17(28-15)23(19)25)22-13-26-18(12-27-22)16-7-5-14(10-20(16)33)24-30-29-21-4-2-3-9-32(21)24/h2-5,7,9-10,12-13,15,17,19,23,28,33H,6,8,11H2,1H3/t15?,17?,19-,23+/m0/s1 |
| InChIKey | LFDITIPVWIKKGJ-VWSJKYDOSA-N |
| XLogP | 3.23 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |