C20H22N6O2S — CID 167368827
2-[5-[[(1R,3R,5S)-1,8-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]oxy]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol (PubChem CID 167368827) has the molecular formula C20H22N6O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[5-[[(1R,3R,5S)-1,8-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]oxy]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol.
| Compound Name | 2-[5-[[(1R,3R,5S)-1,8-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]oxy]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol |
|---|---|
| PubChem CID | 167368827 |
| Molecular Formula | C20H22N6O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[5-[[(1R,3R,5S)-1,8-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]oxy]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol |
| SMILES | Cc1cnn(-c2ccc(-c3nnc(O[C@@H]4C[C@H]5C=C[C@@](C)(C4)N5C)s3)c(O)c2)n1 |
| InChI | InChI=1S/C20H22N6O2S/c1-12-11-21-26(24-12)14-4-5-16(17(27)9-14)18-22-23-19(29-18)28-15-8-13-6-7-20(2,10-15)25(13)3/h4-7,9,11,13,15,27H,8,10H2,1-3H3/t13-,15-,20+/m1/s1 |
| InChIKey | SNCRROXIJLHQGR-RCDCFZSISA-N |
| XLogP | 2.97 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|