About CID 167368962
CID 167368962 (PubChem CID 167368962) has the molecular formula C4H8BN2O2
and a molecular weight of 126.93 g/mol.
Molecular Properties
| Compound Name | CID 167368962 |
| PubChem CID | 167368962 |
| Molecular Formula | C4H8BN2O2 |
| Molecular Weight | 126.93 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | — |
| SMILES | C/N=C/C(=C\N)O[B]O |
| InChI | InChI=1S/C4H8BN2O2/c1-7-3-4(2-6)9-5-8/h2-3,8H,6H2,1H3/b4-2+,7-3+ |
| InChIKey | YOUZGHGZLLRGDK-JKEDICHKSA-N |
| XLogP | -0.97 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.93 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 167368962 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167368962?
The IUPAC name of CID 167368962 (CID 167368962) is not available.
What is the SMILES notation for CID 167368962?
The canonical SMILES for CID 167368962 is C/N=C/C(=C\N)O[B]O.
What is the InChIKey of CID 167368962?
The InChIKey is YOUZGHGZLLRGDK-JKEDICHKSA-N. The full InChI is InChI=1S/C4H8BN2O2/c1-7-3-4(2-6)9-5-8/h2-3,8H,6H2,1H3/b4-2+,7-3+.
What are the key properties of CID 167368962?
CID 167368962 has a molecular weight of 126.93 g/mol, XLogP of -0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167368962 is sourced from PubChem (CID 167368962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).