C24H28FN5O3 — CID 167369738
2-[6-[[(1S,2R,3R,5S,6R)-2-fluoro-6-methoxy-1,5,8-trimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]pyridazin-3-yl]-5-imidazol-1-ylphenol (PubChem CID 167369738) has the molecular formula C24H28FN5O3 and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-[6-[[(1S,2R,3R,5S,6R)-2-fluoro-6-methoxy-1,5,8-trimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]pyridazin-3-yl]-5-imidazol-1-ylphenol.
| Compound Name | 2-[6-[[(1S,2R,3R,5S,6R)-2-fluoro-6-methoxy-1,5,8-trimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]pyridazin-3-yl]-5-imidazol-1-ylphenol |
|---|---|
| PubChem CID | 167369738 |
| Molecular Formula | C24H28FN5O3 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 2-[6-[[(1S,2R,3R,5S,6R)-2-fluoro-6-methoxy-1,5,8-trimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]pyridazin-3-yl]-5-imidazol-1-ylphenol |
| SMILES | CO[C@@H]1C[C@@]2(C)[C@@H](F)[C@H](Oc3ccc(-c4ccc(-n5ccnc5)cc4O)nn3)C[C@]1(C)N2C |
| InChI | InChI=1S/C24H28FN5O3/c1-23-12-19(22(25)24(2,29(23)3)13-20(23)32-4)33-21-8-7-17(27-28-21)16-6-5-15(11-18(16)31)30-10-9-26-14-30/h5-11,14,19-20,22,31H,12-13H2,1-4H3/t19-,20-,22+,23+,24+/m1/s1 |
| InChIKey | UKYXQPBAUPLZOD-QISNUPPCSA-N |
| XLogP | 3.39 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |