C28H33F2N3O5 — CID 167370633
methyl (2S)-2-[[2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine-4-carboxylate (PubChem CID 167370633) has the molecular formula C28H33F2N3O5 and a molecular weight of 529.58 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine-4-carboxylate.
| Compound Name | methyl (2S)-2-[[2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 167370633 |
| Molecular Formula | C28H33F2N3O5 |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | methyl (2S)-2-[[2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine-4-carboxylate |
| SMILES | COC(=O)N1CCO[C@@H](Cc2c(-c3c(F)cc(C4OC(C)(C)C(C)(C)O4)cc3F)nc3cc(C)ccn23)C1 |
| InChI | InChI=1S/C28H33F2N3O5/c1-16-7-8-33-21(14-18-15-32(9-10-36-18)26(34)35-6)24(31-22(33)11-16)23-19(29)12-17(13-20(23)30)25-37-27(2,3)28(4,5)38-25/h7-8,11-13,18,25H,9-10,14-15H2,1-6H3/t18-/m0/s1 |
| InChIKey | IQNCKBAQVSQBOD-SFHVURJKSA-N |
| XLogP | 5.20 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |