C21H25FN6O3S2 — CID 167370931
1-[(cyanoamino)-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]urea (PubChem CID 167370931) has the molecular formula C21H25FN6O3S2 and a molecular weight of 492.60 g/mol. Its IUPAC name is 1-[(cyanoamino)-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[(cyanoamino)-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 167370931 |
| Molecular Formula | C21H25FN6O3S2 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 1-[(cyanoamino)-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CC(C)c1cc(C#N)c(F)c(C(C)C)c1NC(=O)N=S(=O)(NC#N)c1cnc(C(C)(C)O)s1 |
| InChI | InChI=1S/C21H25FN6O3S2/c1-11(2)14-7-13(8-23)17(22)16(12(3)4)18(14)27-20(29)28-33(31,26-10-24)15-9-25-19(32-15)21(5,6)30/h7,9,11-12,30H,1-6H3,(H2,26,27,28,29,31) |
| InChIKey | UNQSDXBUAPVWCH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|