About 1-hydroxy-2,3,5-trimethylpyridin-4-imine
1-hydroxy-2,3,5-trimethylpyridin-4-imine (PubChem CID 16737139) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-hydroxy-2,3,5-trimethylpyridin-4-imine.
Molecular Properties
| Compound Name | 1-hydroxy-2,3,5-trimethylpyridin-4-imine |
| PubChem CID | 16737139 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 1-hydroxy-2,3,5-trimethylpyridin-4-imine |
| SMILES | [H]/N=c1\c(C)cn(O)c(C)c1C |
| InChI | InChI=1S/C8H12N2O/c1-5-4-10(11)7(3)6(2)8(5)9/h4,9,11H,1-3H3/b9-8+ |
| InChIKey | LYEZAIACRGRYCO-CMDGGOBGSA-N |
| XLogP | 1.13 |
| TPSA | 49.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-2,3,5-trimethylpyridin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2,3,5-trimethylpyridin-4-imine?
The IUPAC name of 1-hydroxy-2,3,5-trimethylpyridin-4-imine (CID 16737139) is 1-hydroxy-2,3,5-trimethylpyridin-4-imine.
What is the SMILES notation for 1-hydroxy-2,3,5-trimethylpyridin-4-imine?
The canonical SMILES for 1-hydroxy-2,3,5-trimethylpyridin-4-imine is [H]/N=c1\c(C)cn(O)c(C)c1C.
What is the InChIKey of 1-hydroxy-2,3,5-trimethylpyridin-4-imine?
The InChIKey is LYEZAIACRGRYCO-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H12N2O/c1-5-4-10(11)7(3)6(2)8(5)9/h4,9,11H,1-3H3/b9-8+.
What are the key properties of 1-hydroxy-2,3,5-trimethylpyridin-4-imine?
1-hydroxy-2,3,5-trimethylpyridin-4-imine has a molecular weight of 152.20 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,3,5-trimethylpyridin-4-imine is sourced from PubChem (CID 16737139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).