C12H20N2 — CID 16737421
(2R)-6-methyl-2-pentyl-1,2,3,4-tetrahydropyridine-5-carbonitrile (PubChem CID 16737421) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (2R)-6-methyl-2-pentyl-1,2,3,4-tetrahydropyridine-5-carbonitrile.
| Compound Name | (2R)-6-methyl-2-pentyl-1,2,3,4-tetrahydropyridine-5-carbonitrile |
|---|---|
| PubChem CID | 16737421 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (2R)-6-methyl-2-pentyl-1,2,3,4-tetrahydropyridine-5-carbonitrile |
| SMILES | CCCCC[C@@H]1CCC(C#N)=C(C)N1 |
| InChI | InChI=1S/C12H20N2/c1-3-4-5-6-12-8-7-11(9-13)10(2)14-12/h12,14H,3-8H2,1-2H3/t12-/m1/s1 |
| InChIKey | OJUCGQJKLMEQLN-GFCCVEGCSA-N |
| XLogP | 3.12 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|