C29H32O9 — CID 16737472
(4R,5S)-4,5-dimethyl-4,5-bis[2-(3,4,6-trimethoxy-2-methylphenyl)ethynyl]-1,3-dioxolan-2-one (PubChem CID 16737472) has the molecular formula C29H32O9 and a molecular weight of 524.57 g/mol. Its IUPAC name is (4R,5S)-4,5-dimethyl-4,5-bis[2-(3,4,6-trimethoxy-2-methylphenyl)ethynyl]-1,3-dioxolan-2-one.
| Compound Name | (4R,5S)-4,5-dimethyl-4,5-bis[2-(3,4,6-trimethoxy-2-methylphenyl)ethynyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 16737472 |
| Molecular Formula | C29H32O9 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | (4R,5S)-4,5-dimethyl-4,5-bis[2-(3,4,6-trimethoxy-2-methylphenyl)ethynyl]-1,3-dioxolan-2-one |
| SMILES | COc1cc(OC)c(OC)c(C)c1C#C[C@@]1(C)OC(=O)O[C@@]1(C)C#Cc1c(OC)cc(OC)c(OC)c1C |
| InChI | InChI=1S/C29H32O9/c1-17-19(21(31-5)15-23(33-7)25(17)35-9)11-13-28(3)29(4,38-27(30)37-28)14-12-20-18(2)26(36-10)24(34-8)16-22(20)32-6/h15-16H,1-10H3/t28-,29+ |
| InChIKey | NJECTZSLZHQUFD-ISILISOKSA-N |
| XLogP | 4.44 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|