About [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate
[8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate (PubChem CID 167375301) has the molecular formula C17H21F3O5S
and a molecular weight of 394.41 g/mol. Its IUPAC name is [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate |
| PubChem CID | 167375301 |
| Molecular Formula | C17H21F3O5S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(C(F)(F)F)CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C17H21F3O5S/c1-13-2-4-14(5-3-13)26(21,22)25-12-15(17(18,19)20)6-8-16(9-7-15)23-10-11-24-16/h2-5H,6-12H2,1H3 |
| InChIKey | WMUDAEILPQQJOT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate?
The IUPAC name of [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate (CID 167375301) is [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate.
What is the SMILES notation for [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate?
The canonical SMILES for [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC2(C(F)(F)F)CCC3(CC2)OCCO3)cc1.
What is the InChIKey of [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate?
The InChIKey is WMUDAEILPQQJOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F3O5S/c1-13-2-4-14(5-3-13)26(21,22)25-12-15(17(18,19)20)6-8-16(9-7-15)23-10-11-24-16/h2-5H,6-12H2,1H3.
What are the key properties of [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate?
[8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate has a molecular weight of 394.41 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 167375301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).