C40H40N6O2 — CID 167375877
(2R)-2-methyl-4-[5-[4-(4-trityl-1,2,4-triazol-3-yl)cyclohexyl]oxy-1,6-naphthyridin-7-yl]morpholine (PubChem CID 167375877) has the molecular formula C40H40N6O2 and a molecular weight of 636.80 g/mol. Its IUPAC name is (2R)-2-methyl-4-[5-[4-(4-trityl-1,2,4-triazol-3-yl)cyclohexyl]oxy-1,6-naphthyridin-7-yl]morpholine.
| Compound Name | (2R)-2-methyl-4-[5-[4-(4-trityl-1,2,4-triazol-3-yl)cyclohexyl]oxy-1,6-naphthyridin-7-yl]morpholine |
|---|---|
| PubChem CID | 167375877 |
| Molecular Formula | C40H40N6O2 |
| Molecular Weight | 636.80 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | (2R)-2-methyl-4-[5-[4-(4-trityl-1,2,4-triazol-3-yl)cyclohexyl]oxy-1,6-naphthyridin-7-yl]morpholine |
| SMILES | C[C@@H]1CN(c2cc3ncccc3c(OC3CCC(c4nncn4C(c4ccccc4)(c4ccccc4)c4ccccc4)CC3)n2)CCO1 |
| InChI | InChI=1S/C40H40N6O2/c1-29-27-45(24-25-47-29)37-26-36-35(18-11-23-41-36)39(43-37)48-34-21-19-30(20-22-34)38-44-42-28-46(38)40(31-12-5-2-6-13-31,32-14-7-3-8-15-32)33-16-9-4-10-17-33/h2-18,23,26,28-30,34H,19-22,24-25,27H2,1H3/t29-,30?,34?/m1/s1 |
| InChIKey | GPDRWLPKHHZOSC-NYMLNQHWSA-N |
| XLogP | 7.39 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.80 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|