C23H40N2O3Si — CID 167375984
tert-butyl N-[(3S,5S)-1-benzyl-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]piperidin-3-yl]carbamate (PubChem CID 167375984) has the molecular formula C23H40N2O3Si and a molecular weight of 420.67 g/mol. Its IUPAC name is tert-butyl N-[(3S,5S)-1-benzyl-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5S)-1-benzyl-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 167375984 |
| Molecular Formula | C23H40N2O3Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | tert-butyl N-[(3S,5S)-1-benzyl-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H](CC(C)(C)[Si](C)(C)O)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H40N2O3Si/c1-22(2,3)28-21(26)24-20-13-19(14-23(4,5)29(6,7)27)16-25(17-20)15-18-11-9-8-10-12-18/h8-12,19-20,27H,13-17H2,1-7H3,(H,24,26)/t19-,20-/m0/s1 |
| InChIKey | GFZOBURHUMIJKO-PMACEKPBSA-N |
| XLogP | 4.77 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|