C34H42BN5O4 — CID 167376015
tert-butyl (3S)-3-[[4-(1-phenylindol-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 167376015) has the molecular formula C34H42BN5O4 and a molecular weight of 595.55 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[4-(1-phenylindol-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[4-(1-phenylindol-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167376015 |
| Molecular Formula | C34H42BN5O4 |
| Molecular Weight | 595.55 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | tert-butyl (3S)-3-[[4-(1-phenylindol-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](Nc2ncc(B3OC(C)(C)C(C)(C)O3)c(-c3cn(-c4ccccc4)c4ccccc34)n2)C1 |
| InChI | InChI=1S/C34H42BN5O4/c1-32(2,3)42-31(41)39-19-13-14-23(21-39)37-30-36-20-27(35-43-33(4,5)34(6,7)44-35)29(38-30)26-22-40(24-15-9-8-10-16-24)28-18-12-11-17-25(26)28/h8-12,15-18,20,22-23H,13-14,19,21H2,1-7H3,(H,36,37,38)/t23-/m0/s1 |
| InChIKey | LRCRGSGAQKQWTI-QHCPKHFHSA-N |
| XLogP | 6.20 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.55 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|