C33H39N5O2Si — CID 167376042
tert-butyl (3S)-3-[[4-(1-phenylindol-3-yl)-5-(2-trimethylsilylethynyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 167376042) has the molecular formula C33H39N5O2Si and a molecular weight of 565.79 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[4-(1-phenylindol-3-yl)-5-(2-trimethylsilylethynyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[4-(1-phenylindol-3-yl)-5-(2-trimethylsilylethynyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167376042 |
| Molecular Formula | C33H39N5O2Si |
| Molecular Weight | 565.79 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | tert-butyl (3S)-3-[[4-(1-phenylindol-3-yl)-5-(2-trimethylsilylethynyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](Nc2ncc(C#C[Si](C)(C)C)c(-c3cn(-c4ccccc4)c4ccccc34)n2)C1 |
| InChI | InChI=1S/C33H39N5O2Si/c1-33(2,3)40-32(39)37-19-12-13-25(22-37)35-31-34-21-24(18-20-41(4,5)6)30(36-31)28-23-38(26-14-8-7-9-15-26)29-17-11-10-16-27(28)29/h7-11,14-17,21,23,25H,12-13,19,22H2,1-6H3,(H,34,35,36)/t25-/m0/s1 |
| InChIKey | HUZKKJUOSZIRAA-VWLOTQADSA-N |
| XLogP | 7.13 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.79 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|